C17H17F4N3 — CID 120768312
1-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-pyridin-3-ylpiperazine (PubChem CID 120768312) has the molecular formula C17H17F4N3 and a molecular weight of 339.34 g/mol. Its IUPAC name is 1-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-pyridin-3-ylpiperazine.
| Compound Name | 1-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-pyridin-3-ylpiperazine |
|---|---|
| PubChem CID | 120768312 |
| Molecular Formula | C17H17F4N3 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 1-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-pyridin-3-ylpiperazine |
| SMILES | Fc1cc(CN2CCNCC2c2cccnc2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H17F4N3/c18-15-7-12(6-14(8-15)17(19,20)21)11-24-5-4-23-10-16(24)13-2-1-3-22-9-13/h1-3,6-9,16,23H,4-5,10-11H2 |
| InChIKey | WJNUAJPDCDORDL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |