C19H25N3 — CID 120768364
2-pyridin-3-yl-1-[(2,4,5-trimethylphenyl)methyl]piperazine (PubChem CID 120768364) has the molecular formula C19H25N3 and a molecular weight of 295.43 g/mol. Its IUPAC name is 2-pyridin-3-yl-1-[(2,4,5-trimethylphenyl)methyl]piperazine.
| Compound Name | 2-pyridin-3-yl-1-[(2,4,5-trimethylphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 120768364 |
| Molecular Formula | C19H25N3 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | 2-pyridin-3-yl-1-[(2,4,5-trimethylphenyl)methyl]piperazine |
| SMILES | Cc1cc(C)c(CN2CCNCC2c2cccnc2)cc1C |
| InChI | InChI=1S/C19H25N3/c1-14-9-16(3)18(10-15(14)2)13-22-8-7-21-12-19(22)17-5-4-6-20-11-17/h4-6,9-11,19,21H,7-8,12-13H2,1-3H3 |
| InChIKey | HCNPMPGUZIIYDV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |