C16H17Cl2N3 — CID 120754425
1-[(2,5-dichlorophenyl)methyl]-2-pyridin-3-ylpiperazine (PubChem CID 120754425) has the molecular formula C16H17Cl2N3 and a molecular weight of 322.24 g/mol. Its IUPAC name is 1-[(2,5-dichlorophenyl)methyl]-2-pyridin-3-ylpiperazine.
| Compound Name | 1-[(2,5-dichlorophenyl)methyl]-2-pyridin-3-ylpiperazine |
|---|---|
| PubChem CID | 120754425 |
| Molecular Formula | C16H17Cl2N3 |
| Molecular Weight | 322.24 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 1-[(2,5-dichlorophenyl)methyl]-2-pyridin-3-ylpiperazine |
| SMILES | Clc1ccc(Cl)c(CN2CCNCC2c2cccnc2)c1 |
| InChI | InChI=1S/C16H17Cl2N3/c17-14-3-4-15(18)13(8-14)11-21-7-6-20-10-16(21)12-2-1-5-19-9-12/h1-5,8-9,16,20H,6-7,10-11H2 |
| InChIKey | UGQMEDXMCVYQPF-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.24 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |