C16H18ClN3 — CID 120780257
2-(3-chlorophenyl)-1-(pyridin-3-ylmethyl)piperazine (PubChem CID 120780257) has the molecular formula C16H18ClN3 and a molecular weight of 287.79 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-(pyridin-3-ylmethyl)piperazine.
| Compound Name | 2-(3-chlorophenyl)-1-(pyridin-3-ylmethyl)piperazine |
|---|---|
| PubChem CID | 120780257 |
| Molecular Formula | C16H18ClN3 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 2-(3-chlorophenyl)-1-(pyridin-3-ylmethyl)piperazine |
| SMILES | Clc1cccc(C2CNCCN2Cc2cccnc2)c1 |
| InChI | InChI=1S/C16H18ClN3/c17-15-5-1-4-14(9-15)16-11-19-7-8-20(16)12-13-3-2-6-18-10-13/h1-6,9-10,16,19H,7-8,11-12H2 |
| InChIKey | LPGYLUPPNJFNED-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |