C18H22N4O — CID 124952417
N-methyl-3-[(2S)-1-(pyridin-3-ylmethyl)piperazin-2-yl]benzamide (PubChem CID 124952417) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is N-methyl-3-[(2S)-1-(pyridin-3-ylmethyl)piperazin-2-yl]benzamide.
| Compound Name | N-methyl-3-[(2S)-1-(pyridin-3-ylmethyl)piperazin-2-yl]benzamide |
|---|---|
| PubChem CID | 124952417 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | N-methyl-3-[(2S)-1-(pyridin-3-ylmethyl)piperazin-2-yl]benzamide |
| SMILES | CNC(=O)c1cccc([C@H]2CNCCN2Cc2cccnc2)c1 |
| InChI | InChI=1S/C18H22N4O/c1-19-18(23)16-6-2-5-15(10-16)17-12-21-8-9-22(17)13-14-4-3-7-20-11-14/h2-7,10-11,17,21H,8-9,12-13H2,1H3,(H,19,23)/t17-/m1/s1 |
| InChIKey | DODAFLAYTFXLDI-QGZVFWFLSA-N |
| XLogP | 1.59 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |