C16H20N4OS — CID 124962672
N-methyl-3-[(2R)-1-(1,3-thiazol-4-ylmethyl)piperazin-2-yl]benzamide (PubChem CID 124962672) has the molecular formula C16H20N4OS and a molecular weight of 316.43 g/mol. Its IUPAC name is N-methyl-3-[(2R)-1-(1,3-thiazol-4-ylmethyl)piperazin-2-yl]benzamide.
| Compound Name | N-methyl-3-[(2R)-1-(1,3-thiazol-4-ylmethyl)piperazin-2-yl]benzamide |
|---|---|
| PubChem CID | 124962672 |
| Molecular Formula | C16H20N4OS |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | N-methyl-3-[(2R)-1-(1,3-thiazol-4-ylmethyl)piperazin-2-yl]benzamide |
| SMILES | CNC(=O)c1cccc([C@@H]2CNCCN2Cc2cscn2)c1 |
| InChI | InChI=1S/C16H20N4OS/c1-17-16(21)13-4-2-3-12(7-13)15-8-18-5-6-20(15)9-14-10-22-11-19-14/h2-4,7,10-11,15,18H,5-6,8-9H2,1H3,(H,17,21)/t15-/m0/s1 |
| InChIKey | HKNAKLGRHDGOMM-HNNXBMFYSA-N |
| XLogP | 1.65 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |