C22H30N6O2 — CID 110122331
3-[1-[2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl]piperazin-2-yl]-N-methylbenzamide (PubChem CID 110122331) has the molecular formula C22H30N6O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is 3-[1-[2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl]piperazin-2-yl]-N-methylbenzamide.
| Compound Name | 3-[1-[2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl]piperazin-2-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 110122331 |
| Molecular Formula | C22H30N6O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 3-[1-[2-[(2-cyclopentylpyrazol-3-yl)amino]-2-oxoethyl]piperazin-2-yl]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(C2CNCCN2CC(=O)Nc2ccnn2C2CCCC2)c1 |
| InChI | InChI=1S/C22H30N6O2/c1-23-22(30)17-6-4-5-16(13-17)19-14-24-11-12-27(19)15-21(29)26-20-9-10-25-28(20)18-7-2-3-8-18/h4-6,9-10,13,18-19,24H,2-3,7-8,11-12,14-15H2,1H3,(H,23,30)(H,26,29) |
| InChIKey | WBHCSDXDBNPANJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |