C17H21ClFN3 — CID 120768241
1-[(5-fluoro-2-methylphenyl)methyl]-2-pyridin-3-ylpiperazine;hydrochloride (PubChem CID 120768241) has the molecular formula C17H21ClFN3 and a molecular weight of 321.83 g/mol. Its IUPAC name is 1-[(5-fluoro-2-methylphenyl)methyl]-2-pyridin-3-ylpiperazine;hydrochloride.
| Compound Name | 1-[(5-fluoro-2-methylphenyl)methyl]-2-pyridin-3-ylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120768241 |
| Molecular Formula | C17H21ClFN3 |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 1-[(5-fluoro-2-methylphenyl)methyl]-2-pyridin-3-ylpiperazine;hydrochloride |
| SMILES | Cc1ccc(F)cc1CN1CCNCC1c1cccnc1.Cl |
| InChI | InChI=1S/C17H20FN3.ClH/c1-13-4-5-16(18)9-15(13)12-21-8-7-20-11-17(21)14-3-2-6-19-10-14;/h2-6,9-10,17,20H,7-8,11-12H2,1H3;1H |
| InChIKey | MHVSLDQYQRINTA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |