C15H19ClN4 — CID 120768365
2-pyridin-3-yl-1-(pyridin-2-ylmethyl)piperazine;hydrochloride (PubChem CID 120768365) has the molecular formula C15H19ClN4 and a molecular weight of 290.80 g/mol. Its IUPAC name is 2-pyridin-3-yl-1-(pyridin-2-ylmethyl)piperazine;hydrochloride.
| Compound Name | 2-pyridin-3-yl-1-(pyridin-2-ylmethyl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 120768365 |
| Molecular Formula | C15H19ClN4 |
| Molecular Weight | 290.80 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-pyridin-3-yl-1-(pyridin-2-ylmethyl)piperazine;hydrochloride |
| SMILES | Cl.c1ccc(CN2CCNCC2c2cccnc2)nc1 |
| InChI | InChI=1S/C15H18N4.ClH/c1-2-7-18-14(5-1)12-19-9-8-17-11-15(19)13-4-3-6-16-10-13;/h1-7,10,15,17H,8-9,11-12H2;1H |
| InChIKey | DLAZKYUATMFSSL-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.80 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |