C13H17ClN2 — CID 120770958
2-(3-chlorophenyl)-1-prop-2-enylpiperazine (PubChem CID 120770958) has the molecular formula C13H17ClN2 and a molecular weight of 236.75 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-prop-2-enylpiperazine.
| Compound Name | 2-(3-chlorophenyl)-1-prop-2-enylpiperazine |
|---|---|
| PubChem CID | 120770958 |
| Molecular Formula | C13H17ClN2 |
| Molecular Weight | 236.75 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 2-(3-chlorophenyl)-1-prop-2-enylpiperazine |
| SMILES | C=CCN1CCNCC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H17ClN2/c1-2-7-16-8-6-15-10-13(16)11-4-3-5-12(14)9-11/h2-5,9,13,15H,1,6-8,10H2 |
| InChIKey | KLKCLGRBMJUFMB-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.75 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|