C14H20Cl2N2 — CID 120771105
1-but-3-enyl-2-(3-chlorophenyl)piperazine;hydrochloride (PubChem CID 120771105) has the molecular formula C14H20Cl2N2 and a molecular weight of 287.23 g/mol. Its IUPAC name is 1-but-3-enyl-2-(3-chlorophenyl)piperazine;hydrochloride.
| Compound Name | 1-but-3-enyl-2-(3-chlorophenyl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 120771105 |
| Molecular Formula | C14H20Cl2N2 |
| Molecular Weight | 287.23 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 1-but-3-enyl-2-(3-chlorophenyl)piperazine;hydrochloride |
| SMILES | C=CCCN1CCNCC1c1cccc(Cl)c1.Cl |
| InChI | InChI=1S/C14H19ClN2.ClH/c1-2-3-8-17-9-7-16-11-14(17)12-5-4-6-13(15)10-12;/h2,4-6,10,14,16H,1,3,7-9,11H2;1H |
| InChIKey | OJYVJBNPYQJBFL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.23 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|