C19H22Cl2N6 — CID 120771011
2-(3-chlorophenyl)-1-[2-(1-phenyltetrazol-5-yl)ethyl]piperazine;hydrochloride (PubChem CID 120771011) has the molecular formula C19H22Cl2N6 and a molecular weight of 405.33 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-[2-(1-phenyltetrazol-5-yl)ethyl]piperazine;hydrochloride.
| Compound Name | 2-(3-chlorophenyl)-1-[2-(1-phenyltetrazol-5-yl)ethyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 120771011 |
| Molecular Formula | C19H22Cl2N6 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 2-(3-chlorophenyl)-1-[2-(1-phenyltetrazol-5-yl)ethyl]piperazine;hydrochloride |
| SMILES | Cl.Clc1cccc(C2CNCCN2CCc2nnnn2-c2ccccc2)c1 |
| InChI | InChI=1S/C19H21ClN6.ClH/c20-16-6-4-5-15(13-16)18-14-21-10-12-25(18)11-9-19-22-23-24-26(19)17-7-2-1-3-8-17;/h1-8,13,18,21H,9-12,14H2;1H |
| InChIKey | WLSWRRMZXICSEZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |