C15H19Cl2N5O2 — CID 120770850
2-(3-chlorophenyl)-1-[2-(3-nitropyrazol-1-yl)ethyl]piperazine;hydrochloride (PubChem CID 120770850) has the molecular formula C15H19Cl2N5O2 and a molecular weight of 372.26 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-[2-(3-nitropyrazol-1-yl)ethyl]piperazine;hydrochloride.
| Compound Name | 2-(3-chlorophenyl)-1-[2-(3-nitropyrazol-1-yl)ethyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 120770850 |
| Molecular Formula | C15H19Cl2N5O2 |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 2-(3-chlorophenyl)-1-[2-(3-nitropyrazol-1-yl)ethyl]piperazine;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccn(CCN2CCNCC2c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C15H18ClN5O2.ClH/c16-13-3-1-2-12(10-13)14-11-17-5-7-19(14)8-9-20-6-4-15(18-20)21(22)23;/h1-4,6,10,14,17H,5,7-9,11H2;1H |
| InChIKey | QTKBQRJWQQIKGX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|