C15H16FN5O3 — CID 120737642
1-[2-(3-fluorophenyl)piperazin-1-yl]-2-(3-nitropyrazol-1-yl)ethanone (PubChem CID 120737642) has the molecular formula C15H16FN5O3 and a molecular weight of 333.32 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)piperazin-1-yl]-2-(3-nitropyrazol-1-yl)ethanone.
| Compound Name | 1-[2-(3-fluorophenyl)piperazin-1-yl]-2-(3-nitropyrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 120737642 |
| Molecular Formula | C15H16FN5O3 |
| Molecular Weight | 333.32 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 1-[2-(3-fluorophenyl)piperazin-1-yl]-2-(3-nitropyrazol-1-yl)ethanone |
| SMILES | O=C(Cn1ccc([N+](=O)[O-])n1)N1CCNCC1c1cccc(F)c1 |
| InChI | InChI=1S/C15H16FN5O3/c16-12-3-1-2-11(8-12)13-9-17-5-7-20(13)15(22)10-19-6-4-14(18-19)21(23)24/h1-4,6,8,13,17H,5,7,9-10H2 |
| InChIKey | JGHSKKFSNLAUAZ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.32 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|