C13H15FN6O — CID 120737844
1-[2-(3-fluorophenyl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone (PubChem CID 120737844) has the molecular formula C13H15FN6O and a molecular weight of 290.30 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone.
| Compound Name | 1-[2-(3-fluorophenyl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone |
|---|---|
| PubChem CID | 120737844 |
| Molecular Formula | C13H15FN6O |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 1-[2-(3-fluorophenyl)piperazin-1-yl]-2-(tetrazol-1-yl)ethanone |
| SMILES | O=C(Cn1cnnn1)N1CCNCC1c1cccc(F)c1 |
| InChI | InChI=1S/C13H15FN6O/c14-11-3-1-2-10(6-11)12-7-15-4-5-20(12)13(21)8-19-9-16-17-18-19/h1-3,6,9,12,15H,4-5,7-8H2 |
| InChIKey | IKYQRYUFRGZCHZ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |