C18H22Cl2N2O2S — CID 120770977
1-[2-(benzenesulfonyl)ethyl]-2-(3-chlorophenyl)piperazine;hydrochloride (PubChem CID 120770977) has the molecular formula C18H22Cl2N2O2S and a molecular weight of 401.36 g/mol. Its IUPAC name is 1-[2-(benzenesulfonyl)ethyl]-2-(3-chlorophenyl)piperazine;hydrochloride.
| Compound Name | 1-[2-(benzenesulfonyl)ethyl]-2-(3-chlorophenyl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 120770977 |
| Molecular Formula | C18H22Cl2N2O2S |
| Molecular Weight | 401.36 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 1-[2-(benzenesulfonyl)ethyl]-2-(3-chlorophenyl)piperazine;hydrochloride |
| SMILES | Cl.O=S(=O)(CCN1CCNCC1c1cccc(Cl)c1)c1ccccc1 |
| InChI | InChI=1S/C18H21ClN2O2S.ClH/c19-16-6-4-5-15(13-16)18-14-20-9-10-21(18)11-12-24(22,23)17-7-2-1-3-8-17;/h1-8,13,18,20H,9-12,14H2;1H |
| InChIKey | MLSAZAKIHAPRBN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |