C16H17ClN2O2S — CID 120776858
1-(benzenesulfonyl)-2-(3-chlorophenyl)piperazine (PubChem CID 120776858) has the molecular formula C16H17ClN2O2S and a molecular weight of 336.84 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2-(3-chlorophenyl)piperazine.
| Compound Name | 1-(benzenesulfonyl)-2-(3-chlorophenyl)piperazine |
|---|---|
| PubChem CID | 120776858 |
| Molecular Formula | C16H17ClN2O2S |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 1-(benzenesulfonyl)-2-(3-chlorophenyl)piperazine |
| SMILES | O=S(=O)(c1ccccc1)N1CCNCC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H17ClN2O2S/c17-14-6-4-5-13(11-14)16-12-18-9-10-19(16)22(20,21)15-7-2-1-3-8-15/h1-8,11,16,18H,9-10,12H2 |
| InChIKey | LIXMQSDLTINLNL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |