C15H21ClN2S — CID 120846887
2-(3-chlorophenyl)-1-(thiolan-3-ylmethyl)piperazine (PubChem CID 120846887) has the molecular formula C15H21ClN2S and a molecular weight of 296.87 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-(thiolan-3-ylmethyl)piperazine.
| Compound Name | 2-(3-chlorophenyl)-1-(thiolan-3-ylmethyl)piperazine |
|---|---|
| PubChem CID | 120846887 |
| Molecular Formula | C15H21ClN2S |
| Molecular Weight | 296.87 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 2-(3-chlorophenyl)-1-(thiolan-3-ylmethyl)piperazine |
| SMILES | Clc1cccc(C2CNCCN2CC2CCSC2)c1 |
| InChI | InChI=1S/C15H21ClN2S/c16-14-3-1-2-13(8-14)15-9-17-5-6-18(15)10-12-4-7-19-11-12/h1-3,8,12,15,17H,4-7,9-11H2 |
| InChIKey | AAZBSUNZWQFYBA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.87 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |