C17H22N4O3S — CID 120755301
4-[2-(2-pyridin-3-ylpiperazin-1-yl)ethoxy]benzenesulfonamide (PubChem CID 120755301) has the molecular formula C17H22N4O3S and a molecular weight of 362.45 g/mol. Its IUPAC name is 4-[2-(2-pyridin-3-ylpiperazin-1-yl)ethoxy]benzenesulfonamide.
| Compound Name | 4-[2-(2-pyridin-3-ylpiperazin-1-yl)ethoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 120755301 |
| Molecular Formula | C17H22N4O3S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 4-[2-(2-pyridin-3-ylpiperazin-1-yl)ethoxy]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(OCCN2CCNCC2c2cccnc2)cc1 |
| InChI | InChI=1S/C17H22N4O3S/c18-25(22,23)16-5-3-15(4-6-16)24-11-10-21-9-8-20-13-17(21)14-2-1-7-19-12-14/h1-7,12,17,20H,8-11,13H2,(H2,18,22,23) |
| InChIKey | YHIDEJNLQWSPGR-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |