C21H29ClN4O3 — CID 120755971
N-[2-(4-ethoxyphenoxy)ethyl]-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride (PubChem CID 120755971) has the molecular formula C21H29ClN4O3 and a molecular weight of 420.94 g/mol. Its IUPAC name is N-[2-(4-ethoxyphenoxy)ethyl]-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride.
| Compound Name | N-[2-(4-ethoxyphenoxy)ethyl]-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120755971 |
| Molecular Formula | C21H29ClN4O3 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | N-[2-(4-ethoxyphenoxy)ethyl]-2-(2-pyridin-3-ylpiperazin-1-yl)acetamide;hydrochloride |
| SMILES | CCOc1ccc(OCCNC(=O)CN2CCNCC2c2cccnc2)cc1.Cl |
| InChI | InChI=1S/C21H28N4O3.ClH/c1-2-27-18-5-7-19(8-6-18)28-13-11-24-21(26)16-25-12-10-23-15-20(25)17-4-3-9-22-14-17;/h3-9,14,20,23H,2,10-13,15-16H2,1H3,(H,24,26);1H |
| InChIKey | BKQBSHGLCCDWBW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|