C19H24ClN3O3 — CID 120732198
2-(4-ethoxyphenoxy)-1-(2-pyridin-3-ylpiperazin-1-yl)ethanone;hydrochloride (PubChem CID 120732198) has the molecular formula C19H24ClN3O3 and a molecular weight of 377.87 g/mol. Its IUPAC name is 2-(4-ethoxyphenoxy)-1-(2-pyridin-3-ylpiperazin-1-yl)ethanone;hydrochloride.
| Compound Name | 2-(4-ethoxyphenoxy)-1-(2-pyridin-3-ylpiperazin-1-yl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 120732198 |
| Molecular Formula | C19H24ClN3O3 |
| Molecular Weight | 377.87 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 2-(4-ethoxyphenoxy)-1-(2-pyridin-3-ylpiperazin-1-yl)ethanone;hydrochloride |
| SMILES | CCOc1ccc(OCC(=O)N2CCNCC2c2cccnc2)cc1.Cl |
| InChI | InChI=1S/C19H23N3O3.ClH/c1-2-24-16-5-7-17(8-6-16)25-14-19(23)22-11-10-21-13-18(22)15-4-3-9-20-12-15;/h3-9,12,18,21H,2,10-11,13-14H2,1H3;1H |
| InChIKey | GYQIZSWIXUBQCO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.87 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |