C14H22ClN3O — CID 120731237
3-methyl-1-(2-pyridin-3-ylpiperazin-1-yl)butan-1-one;hydrochloride (PubChem CID 120731237) has the molecular formula C14H22ClN3O and a molecular weight of 283.80 g/mol. Its IUPAC name is 3-methyl-1-(2-pyridin-3-ylpiperazin-1-yl)butan-1-one;hydrochloride.
| Compound Name | 3-methyl-1-(2-pyridin-3-ylpiperazin-1-yl)butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120731237 |
| Molecular Formula | C14H22ClN3O |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 3-methyl-1-(2-pyridin-3-ylpiperazin-1-yl)butan-1-one;hydrochloride |
| SMILES | CC(C)CC(=O)N1CCNCC1c1cccnc1.Cl |
| InChI | InChI=1S/C14H21N3O.ClH/c1-11(2)8-14(18)17-7-6-16-10-13(17)12-4-3-5-15-9-12;/h3-5,9,11,13,16H,6-8,10H2,1-2H3;1H |
| InChIKey | JVBNHPYDTBFPIA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |