C18H30ClN3O2 — CID 120730863
3-(4-methylpentan-2-yloxy)-1-(2-pyridin-3-ylpiperazin-1-yl)propan-1-one;hydrochloride (PubChem CID 120730863) has the molecular formula C18H30ClN3O2 and a molecular weight of 355.91 g/mol. Its IUPAC name is 3-(4-methylpentan-2-yloxy)-1-(2-pyridin-3-ylpiperazin-1-yl)propan-1-one;hydrochloride.
| Compound Name | 3-(4-methylpentan-2-yloxy)-1-(2-pyridin-3-ylpiperazin-1-yl)propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120730863 |
| Molecular Formula | C18H30ClN3O2 |
| Molecular Weight | 355.91 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 3-(4-methylpentan-2-yloxy)-1-(2-pyridin-3-ylpiperazin-1-yl)propan-1-one;hydrochloride |
| SMILES | CC(C)CC(C)OCCC(=O)N1CCNCC1c1cccnc1.Cl |
| InChI | InChI=1S/C18H29N3O2.ClH/c1-14(2)11-15(3)23-10-6-18(22)21-9-8-20-13-17(21)16-5-4-7-19-12-16;/h4-5,7,12,14-15,17,20H,6,8-11,13H2,1-3H3;1H |
| InChIKey | IEGPGWZRUVJERY-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.91 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |