C21H28ClN3O — CID 120730121
2-(4-butylphenyl)-1-(2-pyridin-3-ylpiperazin-1-yl)ethanone;hydrochloride (PubChem CID 120730121) has the molecular formula C21H28ClN3O and a molecular weight of 373.93 g/mol. Its IUPAC name is 2-(4-butylphenyl)-1-(2-pyridin-3-ylpiperazin-1-yl)ethanone;hydrochloride.
| Compound Name | 2-(4-butylphenyl)-1-(2-pyridin-3-ylpiperazin-1-yl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 120730121 |
| Molecular Formula | C21H28ClN3O |
| Molecular Weight | 373.93 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 2-(4-butylphenyl)-1-(2-pyridin-3-ylpiperazin-1-yl)ethanone;hydrochloride |
| SMILES | CCCCc1ccc(CC(=O)N2CCNCC2c2cccnc2)cc1.Cl |
| InChI | InChI=1S/C21H27N3O.ClH/c1-2-3-5-17-7-9-18(10-8-17)14-21(25)24-13-12-23-16-20(24)19-6-4-11-22-15-19;/h4,6-11,15,20,23H,2-3,5,12-14,16H2,1H3;1H |
| InChIKey | ZKPMTEOYGLSGKU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.93 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |