C19H21Cl2N3O — CID 120730016
4-(3,4-dichlorophenyl)-1-(2-pyridin-3-ylpiperazin-1-yl)butan-1-one (PubChem CID 120730016) has the molecular formula C19H21Cl2N3O and a molecular weight of 378.30 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-1-(2-pyridin-3-ylpiperazin-1-yl)butan-1-one.
| Compound Name | 4-(3,4-dichlorophenyl)-1-(2-pyridin-3-ylpiperazin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 120730016 |
| Molecular Formula | C19H21Cl2N3O |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-1-(2-pyridin-3-ylpiperazin-1-yl)butan-1-one |
| SMILES | O=C(CCCc1ccc(Cl)c(Cl)c1)N1CCNCC1c1cccnc1 |
| InChI | InChI=1S/C19H21Cl2N3O/c20-16-7-6-14(11-17(16)21)3-1-5-19(25)24-10-9-23-13-18(24)15-4-2-8-22-12-15/h2,4,6-8,11-12,18,23H,1,3,5,9-10,13H2 |
| InChIKey | LPHBQNWOGULBBY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |