C19H22FN3O2 — CID 120731482
4-(3-fluorophenoxy)-1-(2-pyridin-3-ylpiperazin-1-yl)butan-1-one (PubChem CID 120731482) has the molecular formula C19H22FN3O2 and a molecular weight of 343.40 g/mol. Its IUPAC name is 4-(3-fluorophenoxy)-1-(2-pyridin-3-ylpiperazin-1-yl)butan-1-one.
| Compound Name | 4-(3-fluorophenoxy)-1-(2-pyridin-3-ylpiperazin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 120731482 |
| Molecular Formula | C19H22FN3O2 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 4-(3-fluorophenoxy)-1-(2-pyridin-3-ylpiperazin-1-yl)butan-1-one |
| SMILES | O=C(CCCOc1cccc(F)c1)N1CCNCC1c1cccnc1 |
| InChI | InChI=1S/C19H22FN3O2/c20-16-5-1-6-17(12-16)25-11-3-7-19(24)23-10-9-22-14-18(23)15-4-2-8-21-13-15/h1-2,4-6,8,12-13,18,22H,3,7,9-11,14H2 |
| InChIKey | YOJOCUSKHLUDGL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|