C20H22F2N4O2 — CID 120732163
2,4-difluoro-N-[4-oxo-4-(2-pyridin-3-ylpiperazin-1-yl)butyl]benzamide (PubChem CID 120732163) has the molecular formula C20H22F2N4O2 and a molecular weight of 388.42 g/mol. Its IUPAC name is 2,4-difluoro-N-[4-oxo-4-(2-pyridin-3-ylpiperazin-1-yl)butyl]benzamide.
| Compound Name | 2,4-difluoro-N-[4-oxo-4-(2-pyridin-3-ylpiperazin-1-yl)butyl]benzamide |
|---|---|
| PubChem CID | 120732163 |
| Molecular Formula | C20H22F2N4O2 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 2,4-difluoro-N-[4-oxo-4-(2-pyridin-3-ylpiperazin-1-yl)butyl]benzamide |
| SMILES | O=C(NCCCC(=O)N1CCNCC1c1cccnc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C20H22F2N4O2/c21-15-5-6-16(17(22)11-15)20(28)25-8-2-4-19(27)26-10-9-24-13-18(26)14-3-1-7-23-12-14/h1,3,5-7,11-12,18,24H,2,4,8-10,13H2,(H,25,28) |
| InChIKey | PYYDFOKBWAZAOH-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|