C21H24FN3O2 — CID 120737378
N-[4-[2-(3-fluorophenyl)piperazin-1-yl]-4-oxobutyl]benzamide (PubChem CID 120737378) has the molecular formula C21H24FN3O2 and a molecular weight of 369.44 g/mol. Its IUPAC name is N-[4-[2-(3-fluorophenyl)piperazin-1-yl]-4-oxobutyl]benzamide.
| Compound Name | N-[4-[2-(3-fluorophenyl)piperazin-1-yl]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 120737378 |
| Molecular Formula | C21H24FN3O2 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | N-[4-[2-(3-fluorophenyl)piperazin-1-yl]-4-oxobutyl]benzamide |
| SMILES | O=C(NCCCC(=O)N1CCNCC1c1cccc(F)c1)c1ccccc1 |
| InChI | InChI=1S/C21H24FN3O2/c22-18-9-4-8-17(14-18)19-15-23-12-13-25(19)20(26)10-5-11-24-21(27)16-6-2-1-3-7-16/h1-4,6-9,14,19,23H,5,10-13,15H2,(H,24,27) |
| InChIKey | MQUJVLOVRUBRBZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|