C21H32FN3O2 — CID 120736864
5-[2-(3-fluorophenyl)piperazin-1-yl]-5-oxo-N,N-dipropylpentanamide (PubChem CID 120736864) has the molecular formula C21H32FN3O2 and a molecular weight of 377.50 g/mol. Its IUPAC name is 5-[2-(3-fluorophenyl)piperazin-1-yl]-5-oxo-N,N-dipropylpentanamide.
| Compound Name | 5-[2-(3-fluorophenyl)piperazin-1-yl]-5-oxo-N,N-dipropylpentanamide |
|---|---|
| PubChem CID | 120736864 |
| Molecular Formula | C21H32FN3O2 |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 5-[2-(3-fluorophenyl)piperazin-1-yl]-5-oxo-N,N-dipropylpentanamide |
| SMILES | CCCN(CCC)C(=O)CCCC(=O)N1CCNCC1c1cccc(F)c1 |
| InChI | InChI=1S/C21H32FN3O2/c1-3-12-24(13-4-2)20(26)9-6-10-21(27)25-14-11-23-16-19(25)17-7-5-8-18(22)15-17/h5,7-8,15,19,23H,3-4,6,9-14,16H2,1-2H3 |
| InChIKey | RNIPBYBBTHLXPB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |