C22H27N3O2 — CID 120732195
1-(4-propylphenyl)-4-(2-pyridin-3-ylpiperazin-1-yl)butane-1,4-dione (PubChem CID 120732195) has the molecular formula C22H27N3O2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 1-(4-propylphenyl)-4-(2-pyridin-3-ylpiperazin-1-yl)butane-1,4-dione.
| Compound Name | 1-(4-propylphenyl)-4-(2-pyridin-3-ylpiperazin-1-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 120732195 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 1-(4-propylphenyl)-4-(2-pyridin-3-ylpiperazin-1-yl)butane-1,4-dione |
| SMILES | CCCc1ccc(C(=O)CCC(=O)N2CCNCC2c2cccnc2)cc1 |
| InChI | InChI=1S/C22H27N3O2/c1-2-4-17-6-8-18(9-7-17)21(26)10-11-22(27)25-14-13-24-16-20(25)19-5-3-12-23-15-19/h3,5-9,12,15,20,24H,2,4,10-11,13-14,16H2,1H3 |
| InChIKey | HOCYOTHRBLDGKL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |