C17H17FN4O4 — CID 120730484
2-(3-fluoro-4-nitrophenoxy)-1-(2-pyridin-3-ylpiperazin-1-yl)ethanone (PubChem CID 120730484) has the molecular formula C17H17FN4O4 and a molecular weight of 360.35 g/mol. Its IUPAC name is 2-(3-fluoro-4-nitrophenoxy)-1-(2-pyridin-3-ylpiperazin-1-yl)ethanone.
| Compound Name | 2-(3-fluoro-4-nitrophenoxy)-1-(2-pyridin-3-ylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 120730484 |
| Molecular Formula | C17H17FN4O4 |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 2-(3-fluoro-4-nitrophenoxy)-1-(2-pyridin-3-ylpiperazin-1-yl)ethanone |
| SMILES | O=C(COc1ccc([N+](=O)[O-])c(F)c1)N1CCNCC1c1cccnc1 |
| InChI | InChI=1S/C17H17FN4O4/c18-14-8-13(3-4-15(14)22(24)25)26-11-17(23)21-7-6-20-10-16(21)12-2-1-5-19-9-12/h1-5,8-9,16,20H,6-7,10-11H2 |
| InChIKey | PDKPACLLBPKNMR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|