C24H23N3OS — CID 26414987
1-phenothiazin-10-yl-2-[(2R)-2-pyridin-3-ylpiperidin-1-yl]ethanone (PubChem CID 26414987) has the molecular formula C24H23N3OS and a molecular weight of 401.54 g/mol. Its IUPAC name is 1-phenothiazin-10-yl-2-[(2R)-2-pyridin-3-ylpiperidin-1-yl]ethanone.
| Compound Name | 1-phenothiazin-10-yl-2-[(2R)-2-pyridin-3-ylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 26414987 |
| Molecular Formula | C24H23N3OS |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 1-phenothiazin-10-yl-2-[(2R)-2-pyridin-3-ylpiperidin-1-yl]ethanone |
| SMILES | O=C(CN1CCCC[C@@H]1c1cccnc1)N1c2ccccc2Sc2ccccc21 |
| InChI | InChI=1S/C24H23N3OS/c28-24(17-26-15-6-5-9-19(26)18-8-7-14-25-16-18)27-20-10-1-3-12-22(20)29-23-13-4-2-11-21(23)27/h1-4,7-8,10-14,16,19H,5-6,9,15,17H2/t19-/m1/s1 |
| InChIKey | WIGJXCPPBDQPNC-LJQANCHMSA-N |
| XLogP | 5.44 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |