C22H21N3O3S — CID 92949535
(5E)-5-benzylidene-3-[2-oxo-2-[(2S)-2-pyridin-3-ylpiperidin-1-yl]ethyl]-1,3-thiazolidine-2,4-dione (PubChem CID 92949535) has the molecular formula C22H21N3O3S and a molecular weight of 407.50 g/mol. Its IUPAC name is (5E)-5-benzylidene-3-[2-oxo-2-[(2S)-2-pyridin-3-ylpiperidin-1-yl]ethyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-benzylidene-3-[2-oxo-2-[(2S)-2-pyridin-3-ylpiperidin-1-yl]ethyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 92949535 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | (5E)-5-benzylidene-3-[2-oxo-2-[(2S)-2-pyridin-3-ylpiperidin-1-yl]ethyl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1S/C(=C/c2ccccc2)C(=O)N1CC(=O)N1CCCC[C@H]1c1cccnc1 |
| InChI | InChI=1S/C22H21N3O3S/c26-20(24-12-5-4-10-18(24)17-9-6-11-23-14-17)15-25-21(27)19(29-22(25)28)13-16-7-2-1-3-8-16/h1-3,6-9,11,13-14,18H,4-5,10,12,15H2/b19-13+/t18-/m0/s1 |
| InChIKey | BGCZYUKGEHXNHX-DYGKOUCMSA-N |
| XLogP | 3.87 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|