C21H21N3O2S3 — CID 4969928
3-[3-oxo-3-(2-pyridin-3-ylpiperidin-1-yl)propyl]-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one (PubChem CID 4969928) has the molecular formula C21H21N3O2S3 and a molecular weight of 443.62 g/mol. Its IUPAC name is 3-[3-oxo-3-(2-pyridin-3-ylpiperidin-1-yl)propyl]-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one.
| Compound Name | 3-[3-oxo-3-(2-pyridin-3-ylpiperidin-1-yl)propyl]-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4969928 |
| Molecular Formula | C21H21N3O2S3 |
| Molecular Weight | 443.62 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 3-[3-oxo-3-(2-pyridin-3-ylpiperidin-1-yl)propyl]-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=Cc2cccs2)SC(=S)N1CCC(=O)N1CCCCC1c1cccnc1 |
| InChI | InChI=1S/C21H21N3O2S3/c25-19(23-10-2-1-7-17(23)15-5-3-9-22-14-15)8-11-24-20(26)18(29-21(24)27)13-16-6-4-12-28-16/h3-6,9,12-14,17H,1-2,7-8,10-11H2 |
| InChIKey | JWWSQVUNOCKEIL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.62 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|