C21H21N3O3S2 — CID 171135285
3-[3-oxo-3-[(2S)-2-pyridin-3-ylpiperidin-1-yl]propyl]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione (PubChem CID 171135285) has the molecular formula C21H21N3O3S2 and a molecular weight of 427.55 g/mol. Its IUPAC name is 3-[3-oxo-3-[(2S)-2-pyridin-3-ylpiperidin-1-yl]propyl]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[3-oxo-3-[(2S)-2-pyridin-3-ylpiperidin-1-yl]propyl]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 171135285 |
| Molecular Formula | C21H21N3O3S2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 3-[3-oxo-3-[(2S)-2-pyridin-3-ylpiperidin-1-yl]propyl]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1SC(=Cc2cccs2)C(=O)N1CCC(=O)N1CCCC[C@H]1c1cccnc1 |
| InChI | InChI=1S/C21H21N3O3S2/c25-19(23-10-2-1-7-17(23)15-5-3-9-22-14-15)8-11-24-20(26)18(29-21(24)27)13-16-6-4-12-28-16/h3-6,9,12-14,17H,1-2,7-8,10-11H2/t17-/m0/s1 |
| InChIKey | DPCBNJPVKQJMIZ-KRWDZBQOSA-N |
| XLogP | 4.32 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|