C20H22N2O — CID 11871008
(1S)-1-phenyl-4-[(2R)-2-pyridin-3-ylpiperidin-1-yl]but-2-yn-1-ol (PubChem CID 11871008) has the molecular formula C20H22N2O and a molecular weight of 306.41 g/mol. Its IUPAC name is (1S)-1-phenyl-4-[(2R)-2-pyridin-3-ylpiperidin-1-yl]but-2-yn-1-ol.
| Compound Name | (1S)-1-phenyl-4-[(2R)-2-pyridin-3-ylpiperidin-1-yl]but-2-yn-1-ol |
|---|---|
| PubChem CID | 11871008 |
| Molecular Formula | C20H22N2O |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (1S)-1-phenyl-4-[(2R)-2-pyridin-3-ylpiperidin-1-yl]but-2-yn-1-ol |
| SMILES | O[C@H](C#CCN1CCCC[C@@H]1c1cccnc1)c1ccccc1 |
| InChI | InChI=1S/C20H22N2O/c23-20(17-8-2-1-3-9-17)12-7-15-22-14-5-4-11-19(22)18-10-6-13-21-16-18/h1-3,6,8-10,13,16,19-20,23H,4-5,11,14-15H2/t19-,20-/m1/s1 |
| InChIKey | ZDUIFRUINDFUOW-WOJBJXKFSA-N |
| XLogP | 3.35 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|