C20H30N2O — CID 7070083
(4R)-4,7-dimethyl-1-[(2S)-2-pyridin-3-ylpiperidin-1-yl]oct-2-yn-4-ol (PubChem CID 7070083) has the molecular formula C20H30N2O and a molecular weight of 314.47 g/mol. Its IUPAC name is (4R)-4,7-dimethyl-1-[(2S)-2-pyridin-3-ylpiperidin-1-yl]oct-2-yn-4-ol.
| Compound Name | (4R)-4,7-dimethyl-1-[(2S)-2-pyridin-3-ylpiperidin-1-yl]oct-2-yn-4-ol |
|---|---|
| PubChem CID | 7070083 |
| Molecular Formula | C20H30N2O |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.24 |
| IUPAC Name | (4R)-4,7-dimethyl-1-[(2S)-2-pyridin-3-ylpiperidin-1-yl]oct-2-yn-4-ol |
| SMILES | CC(C)CC[C@@](C)(O)C#CCN1CCCC[C@H]1c1cccnc1 |
| InChI | InChI=1S/C20H30N2O/c1-17(2)10-12-20(3,23)11-7-15-22-14-5-4-9-19(22)18-8-6-13-21-16-18/h6,8,13,16-17,19,23H,4-5,9-10,12,14-15H2,1-3H3/t19-,20-/m0/s1 |
| InChIKey | FPZQVDCMRGOONA-PMACEKPBSA-N |
| XLogP | 3.80 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|