C24H30N2O2 — CID 11871006
(3S)-1-(4-methoxyphenyl)-3-methyl-6-[(2R)-2-pyridin-3-ylpiperidin-1-yl]hex-4-yn-3-ol (PubChem CID 11871006) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is (3S)-1-(4-methoxyphenyl)-3-methyl-6-[(2R)-2-pyridin-3-ylpiperidin-1-yl]hex-4-yn-3-ol.
| Compound Name | (3S)-1-(4-methoxyphenyl)-3-methyl-6-[(2R)-2-pyridin-3-ylpiperidin-1-yl]hex-4-yn-3-ol |
|---|---|
| PubChem CID | 11871006 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | (3S)-1-(4-methoxyphenyl)-3-methyl-6-[(2R)-2-pyridin-3-ylpiperidin-1-yl]hex-4-yn-3-ol |
| SMILES | COc1ccc(CC[C@](C)(O)C#CCN2CCCC[C@@H]2c2cccnc2)cc1 |
| InChI | InChI=1S/C24H30N2O2/c1-24(27,15-13-20-9-11-22(28-2)12-10-20)14-6-18-26-17-4-3-8-23(26)21-7-5-16-25-19-21/h5,7,9-12,16,19,23,27H,3-4,8,13,15,17-18H2,1-2H3/t23-,24-/m1/s1 |
| InChIKey | IRUDFFVUOWSUDD-DNQXCXABSA-N |
| XLogP | 4.00 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|