C22H34N2O2 — CID 11870956
(4R)-8-methoxy-4,8-dimethyl-1-[(2R)-2-pyridin-3-ylpiperidin-1-yl]non-2-yn-4-ol (PubChem CID 11870956) has the molecular formula C22H34N2O2 and a molecular weight of 358.53 g/mol. Its IUPAC name is (4R)-8-methoxy-4,8-dimethyl-1-[(2R)-2-pyridin-3-ylpiperidin-1-yl]non-2-yn-4-ol.
| Compound Name | (4R)-8-methoxy-4,8-dimethyl-1-[(2R)-2-pyridin-3-ylpiperidin-1-yl]non-2-yn-4-ol |
|---|---|
| PubChem CID | 11870956 |
| Molecular Formula | C22H34N2O2 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 358.26 |
| IUPAC Name | (4R)-8-methoxy-4,8-dimethyl-1-[(2R)-2-pyridin-3-ylpiperidin-1-yl]non-2-yn-4-ol |
| SMILES | COC(C)(C)CCC[C@@](C)(O)C#CCN1CCCC[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C22H34N2O2/c1-21(2,26-4)12-8-13-22(3,25)14-9-17-24-16-6-5-11-20(24)19-10-7-15-23-18-19/h7,10,15,18,20,25H,5-6,8,11-13,16-17H2,1-4H3/t20-,22-/m1/s1 |
| InChIKey | UBZDIWVELVGWPC-IFMALSPDSA-N |
| XLogP | 3.96 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|