C22H35N2O2+ — CID 11870953
(4S)-8-methoxy-4,8-dimethyl-1-[(2R)-2-pyridin-3-ylpiperidin-1-ium-1-yl]non-2-yn-4-ol (PubChem CID 11870953) has the molecular formula C22H35N2O2+ and a molecular weight of 359.53 g/mol. Its IUPAC name is (4S)-8-methoxy-4,8-dimethyl-1-[(2R)-2-pyridin-3-ylpiperidin-1-ium-1-yl]non-2-yn-4-ol.
| Compound Name | (4S)-8-methoxy-4,8-dimethyl-1-[(2R)-2-pyridin-3-ylpiperidin-1-ium-1-yl]non-2-yn-4-ol |
|---|---|
| PubChem CID | 11870953 |
| Molecular Formula | C22H35N2O2+ |
| Molecular Weight | 359.53 g/mol |
| Exact Mass | 359.27 |
| IUPAC Name | (4S)-8-methoxy-4,8-dimethyl-1-[(2R)-2-pyridin-3-ylpiperidin-1-ium-1-yl]non-2-yn-4-ol |
| SMILES | COC(C)(C)CCC[C@](C)(O)C#CC[NH+]1CCCC[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C22H34N2O2/c1-21(2,26-4)12-8-13-22(3,25)14-9-17-24-16-6-5-11-20(24)19-10-7-15-23-18-19/h7,10,15,18,20,25H,5-6,8,11-13,16-17H2,1-4H3/p+1/t20-,22+/m1/s1 |
| InChIKey | UBZDIWVELVGWPC-IRLDBZIGSA-O |
| XLogP | 2.54 |
| TPSA | 46.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.53 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|