C21H31N2O+ — CID 7069746
3-[(2R)-1-[3-[(2S)-2,6,6-trimethyloxan-2-yl]prop-2-ynyl]piperidin-1-ium-2-yl]pyridine (PubChem CID 7069746) has the molecular formula C21H31N2O+ and a molecular weight of 327.49 g/mol. Its IUPAC name is 3-[(2R)-1-[3-[(2S)-2,6,6-trimethyloxan-2-yl]prop-2-ynyl]piperidin-1-ium-2-yl]pyridine.
| Compound Name | 3-[(2R)-1-[3-[(2S)-2,6,6-trimethyloxan-2-yl]prop-2-ynyl]piperidin-1-ium-2-yl]pyridine |
|---|---|
| PubChem CID | 7069746 |
| Molecular Formula | C21H31N2O+ |
| Molecular Weight | 327.49 g/mol |
| Exact Mass | 327.24 |
| IUPAC Name | 3-[(2R)-1-[3-[(2S)-2,6,6-trimethyloxan-2-yl]prop-2-ynyl]piperidin-1-ium-2-yl]pyridine |
| SMILES | CC1(C)CCC[C@@](C)(C#CC[NH+]2CCCC[C@@H]2c2cccnc2)O1 |
| InChI | InChI=1S/C21H30N2O/c1-20(2)11-7-12-21(3,24-20)13-8-16-23-15-5-4-10-19(23)18-9-6-14-22-17-18/h6,9,14,17,19H,4-5,7,10-12,15-16H2,1-3H3/p+1/t19-,21+/m1/s1 |
| InChIKey | MGHSLDDBTFCNLI-CTNGQTDRSA-O |
| XLogP | 2.93 |
| TPSA | 26.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|