C17H25N2+ — CID 7069756
3-[(2R)-1-hept-2-ynylpiperidin-1-ium-2-yl]pyridine (PubChem CID 7069756) has the molecular formula C17H25N2+ and a molecular weight of 257.40 g/mol. Its IUPAC name is 3-[(2R)-1-hept-2-ynylpiperidin-1-ium-2-yl]pyridine.
| Compound Name | 3-[(2R)-1-hept-2-ynylpiperidin-1-ium-2-yl]pyridine |
|---|---|
| PubChem CID | 7069756 |
| Molecular Formula | C17H25N2+ |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | 3-[(2R)-1-hept-2-ynylpiperidin-1-ium-2-yl]pyridine |
| SMILES | CCCCC#CC[NH+]1CCCC[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C17H24N2/c1-2-3-4-5-7-13-19-14-8-6-11-17(19)16-10-9-12-18-15-16/h9-10,12,15,17H,2-4,6,8,11,13-14H2,1H3/p+1/t17-/m1/s1 |
| InChIKey | IHUGHGYLIPFFKV-QGZVFWFLSA-O |
| XLogP | 2.39 |
| TPSA | 17.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|