C20H31N2O+ — CID 11881716
3-[(2R)-1-[(5S)-5-[(2-methylpropan-2-yl)oxy]hex-2-ynyl]piperidin-1-ium-2-yl]pyridine (PubChem CID 11881716) has the molecular formula C20H31N2O+ and a molecular weight of 315.48 g/mol. Its IUPAC name is 3-[(2R)-1-[(5S)-5-[(2-methylpropan-2-yl)oxy]hex-2-ynyl]piperidin-1-ium-2-yl]pyridine.
| Compound Name | 3-[(2R)-1-[(5S)-5-[(2-methylpropan-2-yl)oxy]hex-2-ynyl]piperidin-1-ium-2-yl]pyridine |
|---|---|
| PubChem CID | 11881716 |
| Molecular Formula | C20H31N2O+ |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.24 |
| IUPAC Name | 3-[(2R)-1-[(5S)-5-[(2-methylpropan-2-yl)oxy]hex-2-ynyl]piperidin-1-ium-2-yl]pyridine |
| SMILES | C[C@@H](CC#CC[NH+]1CCCC[C@@H]1c1cccnc1)OC(C)(C)C |
| InChI | InChI=1S/C20H30N2O/c1-17(23-20(2,3)4)10-5-7-14-22-15-8-6-12-19(22)18-11-9-13-21-16-18/h9,11,13,16-17,19H,6,8,10,12,14-15H2,1-4H3/p+1/t17-,19+/m0/s1 |
| InChIKey | UVYNJXMISCVARO-PKOBYXMFSA-O |
| XLogP | 2.79 |
| TPSA | 26.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|