C22H31N2O+ — CID 8016550
3-[(2S)-1-[2-(2-methyl-5-propan-2-ylphenoxy)ethyl]piperidin-1-ium-2-yl]pyridine (PubChem CID 8016550) has the molecular formula C22H31N2O+ and a molecular weight of 339.50 g/mol. Its IUPAC name is 3-[(2S)-1-[2-(2-methyl-5-propan-2-ylphenoxy)ethyl]piperidin-1-ium-2-yl]pyridine.
| Compound Name | 3-[(2S)-1-[2-(2-methyl-5-propan-2-ylphenoxy)ethyl]piperidin-1-ium-2-yl]pyridine |
|---|---|
| PubChem CID | 8016550 |
| Molecular Formula | C22H31N2O+ |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | 3-[(2S)-1-[2-(2-methyl-5-propan-2-ylphenoxy)ethyl]piperidin-1-ium-2-yl]pyridine |
| SMILES | Cc1ccc(C(C)C)cc1OCC[NH+]1CCCC[C@H]1c1cccnc1 |
| InChI | InChI=1S/C22H30N2O/c1-17(2)19-10-9-18(3)22(15-19)25-14-13-24-12-5-4-8-21(24)20-7-6-11-23-16-20/h6-7,9-11,15-17,21H,4-5,8,12-14H2,1-3H3/p+1/t21-/m0/s1 |
| InChIKey | CLWIQLXJKZBNJC-NRFANRHFSA-O |
| XLogP | 3.70 |
| TPSA | 26.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |