C23H33N2O+ — CID 8016493
3-[(2S)-1-[3-(5-methyl-2-propan-2-ylphenoxy)propyl]piperidin-1-ium-2-yl]pyridine (PubChem CID 8016493) has the molecular formula C23H33N2O+ and a molecular weight of 353.53 g/mol. Its IUPAC name is 3-[(2S)-1-[3-(5-methyl-2-propan-2-ylphenoxy)propyl]piperidin-1-ium-2-yl]pyridine.
| Compound Name | 3-[(2S)-1-[3-(5-methyl-2-propan-2-ylphenoxy)propyl]piperidin-1-ium-2-yl]pyridine |
|---|---|
| PubChem CID | 8016493 |
| Molecular Formula | C23H33N2O+ |
| Molecular Weight | 353.53 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | 3-[(2S)-1-[3-(5-methyl-2-propan-2-ylphenoxy)propyl]piperidin-1-ium-2-yl]pyridine |
| SMILES | Cc1ccc(C(C)C)c(OCCC[NH+]2CCCC[C@H]2c2cccnc2)c1 |
| InChI | InChI=1S/C23H32N2O/c1-18(2)21-11-10-19(3)16-23(21)26-15-7-14-25-13-5-4-9-22(25)20-8-6-12-24-17-20/h6,8,10-12,16-18,22H,4-5,7,9,13-15H2,1-3H3/p+1/t22-/m0/s1 |
| InChIKey | YLWNQOPFOUQOMO-QFIPXVFZSA-O |
| XLogP | 4.09 |
| TPSA | 26.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|