C22H30NO+ — CID 2195526
2-[3-(5-methyl-2-propan-2-ylphenoxy)propyl]-1,2,3,4-tetrahydroisoquinolin-2-ium (PubChem CID 2195526) has the molecular formula C22H30NO+ and a molecular weight of 324.49 g/mol. Its IUPAC name is 2-[3-(5-methyl-2-propan-2-ylphenoxy)propyl]-1,2,3,4-tetrahydroisoquinolin-2-ium.
| Compound Name | 2-[3-(5-methyl-2-propan-2-ylphenoxy)propyl]-1,2,3,4-tetrahydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 2195526 |
| Molecular Formula | C22H30NO+ |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | 2-[3-(5-methyl-2-propan-2-ylphenoxy)propyl]-1,2,3,4-tetrahydroisoquinolin-2-ium |
| SMILES | Cc1ccc(C(C)C)c(OCCC[NH+]2CCc3ccccc3C2)c1 |
| InChI | InChI=1S/C22H29NO/c1-17(2)21-10-9-18(3)15-22(21)24-14-6-12-23-13-11-19-7-4-5-8-20(19)16-23/h4-5,7-10,15,17H,6,11-14,16H2,1-3H3/p+1 |
| InChIKey | RCPSBCNJFQYDLM-UHFFFAOYSA-O |
| XLogP | 3.53 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|