C19H32NO+ — CID 2297151
(3S)-3-methyl-1-[3-(5-methyl-2-propan-2-ylphenoxy)propyl]piperidin-1-ium (PubChem CID 2297151) has the molecular formula C19H32NO+ and a molecular weight of 290.47 g/mol. Its IUPAC name is (3S)-3-methyl-1-[3-(5-methyl-2-propan-2-ylphenoxy)propyl]piperidin-1-ium.
| Compound Name | (3S)-3-methyl-1-[3-(5-methyl-2-propan-2-ylphenoxy)propyl]piperidin-1-ium |
|---|---|
| PubChem CID | 2297151 |
| Molecular Formula | C19H32NO+ |
| Molecular Weight | 290.47 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | (3S)-3-methyl-1-[3-(5-methyl-2-propan-2-ylphenoxy)propyl]piperidin-1-ium |
| SMILES | Cc1ccc(C(C)C)c(OCCC[NH+]2CCC[C@H](C)C2)c1 |
| InChI | InChI=1S/C19H31NO/c1-15(2)18-9-8-16(3)13-19(18)21-12-6-11-20-10-5-7-17(4)14-20/h8-9,13,15,17H,5-7,10-12,14H2,1-4H3/p+1/t17-/m0/s1 |
| InChIKey | XYZHVPDNJGYOKL-KRWDZBQOSA-O |
| XLogP | 3.20 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|