C17H22N2OS — CID 2182341
2-[3-(5-methyl-2-propan-2-ylphenoxy)propylsulfanyl]pyrimidine (PubChem CID 2182341) has the molecular formula C17H22N2OS and a molecular weight of 302.44 g/mol. Its IUPAC name is 2-[3-(5-methyl-2-propan-2-ylphenoxy)propylsulfanyl]pyrimidine.
| Compound Name | 2-[3-(5-methyl-2-propan-2-ylphenoxy)propylsulfanyl]pyrimidine |
|---|---|
| PubChem CID | 2182341 |
| Molecular Formula | C17H22N2OS |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 2-[3-(5-methyl-2-propan-2-ylphenoxy)propylsulfanyl]pyrimidine |
| SMILES | Cc1ccc(C(C)C)c(OCCCSc2ncccn2)c1 |
| InChI | InChI=1S/C17H22N2OS/c1-13(2)15-7-6-14(3)12-16(15)20-10-5-11-21-17-18-8-4-9-19-17/h4,6-9,12-13H,5,10-11H2,1-3H3 |
| InChIKey | XMRKDOZVUDTMBQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|