C19H26ClN2O- — CID 53347743
3-(5-methyl-2-propan-2-ylphenoxy)-N-(pyridin-3-ylmethyl)propan-1-amine chloride (PubChem CID 53347743) has the molecular formula C19H26ClN2O- and a molecular weight of 333.88 g/mol. Its IUPAC name is 3-(5-methyl-2-propan-2-ylphenoxy)-N-(pyridin-3-ylmethyl)propan-1-amine chloride.
| Compound Name | 3-(5-methyl-2-propan-2-ylphenoxy)-N-(pyridin-3-ylmethyl)propan-1-amine chloride |
|---|---|
| PubChem CID | 53347743 |
| Molecular Formula | C19H26ClN2O- |
| Molecular Weight | 333.88 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 3-(5-methyl-2-propan-2-ylphenoxy)-N-(pyridin-3-ylmethyl)propan-1-amine chloride |
| SMILES | Cc1ccc(C(C)C)c(OCCCNCc2cccnc2)c1.[Cl-] |
| InChI | InChI=1S/C19H26N2O.ClH/c1-15(2)18-8-7-16(3)12-19(18)22-11-5-10-21-14-17-6-4-9-20-13-17;/h4,6-9,12-13,15,21H,5,10-11,14H2,1-3H3;1H/p-1 |
| InChIKey | CINRUOLBPQCYFD-UHFFFAOYSA-M |
| XLogP | 1.08 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.88 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|