C18H25N2O+ — CID 7327774
1-[3-[(2R)-2-pyridin-3-ylpiperidin-1-ium-1-yl]prop-1-ynyl]cyclopentan-1-ol (PubChem CID 7327774) has the molecular formula C18H25N2O+ and a molecular weight of 285.41 g/mol. Its IUPAC name is 1-[3-[(2R)-2-pyridin-3-ylpiperidin-1-ium-1-yl]prop-1-ynyl]cyclopentan-1-ol.
| Compound Name | 1-[3-[(2R)-2-pyridin-3-ylpiperidin-1-ium-1-yl]prop-1-ynyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 7327774 |
| Molecular Formula | C18H25N2O+ |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 1-[3-[(2R)-2-pyridin-3-ylpiperidin-1-ium-1-yl]prop-1-ynyl]cyclopentan-1-ol |
| SMILES | OC1(C#CC[NH+]2CCCC[C@@H]2c2cccnc2)CCCC1 |
| InChI | InChI=1S/C18H24N2O/c21-18(9-2-3-10-18)11-6-14-20-13-4-1-8-17(20)16-7-5-12-19-15-16/h5,7,12,15,17,21H,1-4,8-10,13-14H2/p+1/t17-/m1/s1 |
| InChIKey | MQNVBNMTCBVWDQ-QGZVFWFLSA-O |
| XLogP | 1.50 |
| TPSA | 37.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|